CymitQuimica logo

CAS 1086394-74-2

:

benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate

Description:
Benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen atoms and a carboxylate functional group. This compound features a benzyl group, contributing to its aromatic characteristics and potential for various chemical interactions. The presence of the diazaspiro framework indicates that it has a complex three-dimensional arrangement, which can influence its reactivity and interactions with biological systems. Typically, compounds with such structures may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The carboxylate group can participate in hydrogen bonding and ionic interactions, enhancing solubility and reactivity. Additionally, the compound's molecular structure suggests potential applications in drug development, particularly in designing agents that target specific biological pathways. Overall, benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate represents a fascinating example of how structural features can dictate the chemical behavior and potential applications of a substance in various fields, including pharmaceuticals and materials science.
Formula:C15H20N2O2
InChI:InChI=1S/C15H20N2O2/c18-14(19-10-13-4-2-1-3-5-13)17-9-7-15(12-17)6-8-16-11-15/h1-5,16H,6-12H2
InChI key:InChIKey=PLXIARBVQGKHSZ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)N2CC3(CC2)CCNC3
Synonyms:
  • Phenylmethyl 2,7-diazaspiro[4.4]nonane-2-carboxylate
  • 2,7-Diazaspiro[4.4]nonane-2-carboxylic acid, phenylmethyl ester
  • benzyl 2,7-diazaspiro[4.4]nonane-2-carboxylate
  • 2-Cbz-2,7-diaza-spiro[4.4]nonane
  • N-CBZ-2,7-diazaspiro[4.4]nonane
  • 2-Cbz-2,7-diaza-spiro[4.4]nonane - D11551
Found 2 products.