CymitQuimica logo

CAS 1086399-15-6

:

Spiro[3.5]nonane-7-carboxylic acid

Description:
Spiro[3.5]nonane-7-carboxylic acid is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features a carboxylic acid functional group (-COOH) at the 7-position of the nonane framework, contributing to its reactivity and potential applications in organic synthesis. The spiro configuration imparts distinct stereochemical properties, influencing its physical and chemical behavior. Typically, spiro compounds exhibit interesting conformational dynamics due to the constraints imposed by their ring structures. The presence of the carboxylic acid group allows for hydrogen bonding and increases solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications. Overall, Spiro[3.5]nonane-7-carboxylic acid represents a fascinating subject for study in organic chemistry due to its structural complexity and potential utility in synthetic pathways.
Formula:C10H16O2
InChI:InChI=1S/C10H16O2/c11-9(12)8-2-6-10(7-3-8)4-1-5-10/h8H,1-7H2,(H,11,12)
InChI key:InChIKey=HWXCQNVQAKNSHJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCC2(CC1)CCC2
Synonyms:
  • Spiro[3.5]nonane-7-carboxylic acid
Found 3 products.