
CAS 1086409-78-0
:N-Amino-11-azaartemisinin
Description:
N-Amino-11-azaartemisinin is a synthetic derivative of artemisinin, a compound originally derived from the sweet wormwood plant, Artemisia annua, known for its antimalarial properties. This compound features an amino group, which enhances its pharmacological profile. The presence of the nitrogen atom in the 11-position of the bicyclic structure contributes to its unique chemical reactivity and potential biological activity. N-Amino-11-azaartemisinin is characterized by its ability to interact with biological targets, potentially leading to improved efficacy against malaria and other parasitic infections. Its molecular structure includes a lactone ring, which is crucial for its antimalarial activity, and modifications that may influence solubility and bioavailability. Research into this compound focuses on its mechanism of action, safety profile, and therapeutic potential, particularly in overcoming resistance seen with traditional antimalarial drugs. As a relatively novel compound, ongoing studies aim to elucidate its full range of biological effects and optimize its use in clinical settings.
Formula:C15H24N2O4
InChI:InChI=1S/C15H24N2O4/c1-8-4-5-11-9(2)12(18)17(16)13-15(11)10(8)6-7-14(3,19-13)20-21-15/h8-11,13H,4-7,16H2,1-3H3/t8?,9-,10?,11?,13?,14+,15?/m1/s1
InChI key:SDPLWYWNQUROTR-FJAJAOGTSA-N
SMILES:C[C@@H]1C2CCC(C3C24C(N(C1=O)N)O[C@](CC3)(OO4)C)C
Synonyms:- (3R,5aS,6R,8aS,9R,12R,12aR)-11-AMinodecahydro-3,6,9-triMethyl-3,12-epoxy-1,2-dioxepino[4,3-i]isoquinolin-10(3H)-one
- N-Amino-11-azaartemisinin
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
