CymitQuimica logo

CAS 108656-65-1

:

5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine

Description:
5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a bromophenyl substituent. The thiadiazole moiety contributes to its potential biological activity, as thiadiazoles are known for their diverse pharmacological properties. The presence of the bromine atom on the phenyl ring enhances the compound's lipophilicity and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be influenced by the presence of functional groups and the overall molecular geometry. As with many heterocyclic compounds, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic synthesis.
Formula:C8H6BrN3S
InChI:InChI=1S/C8H6BrN3S/c9-6-3-1-2-5(4-6)7-11-12-8(10)13-7/h1-4H,(H2,10,12)
InChI key:InChIKey=GQKBSBAYTFZMIR-UHFFFAOYSA-N
SMILES:BrC=1C=C(C=CC1)C2=NN=C(N)S2
Synonyms:
  • 5-(3-Bromophenyl)-1,3,4-thiadiazol-2-amine
  • 1,3,4-Thiadiazol-2-amine, 5-(3-bromophenyl)-
Found 4 products.