CymitQuimica logo

CAS 108661-54-7

:

1-aminobutan-2-one hydrochloride (1:1)

Description:
1-Aminobutan-2-one hydrochloride (1:1) is a chemical compound characterized by its amine and ketone functional groups, which contribute to its reactivity and potential applications in organic synthesis. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various chemical processes. The presence of the amino group suggests that it may participate in nucleophilic reactions, while the ketone group can engage in condensation reactions or serve as a site for further functionalization. This compound may be utilized in pharmaceutical research, particularly in the development of new drugs or as an intermediate in synthetic pathways. Its molecular structure indicates that it could exhibit both basic and acidic properties, depending on the pH of the environment. Additionally, the compound's stability and reactivity can be influenced by factors such as temperature and solvent choice, making it important to consider these conditions during handling and experimentation. Overall, 1-aminobutan-2-one hydrochloride is a versatile compound with significant implications in chemical research and synthesis.
Formula:C4H10ClNO
InChI:InChI=1/C4H9NO.ClH/c1-2-4(6)3-5;/h2-3,5H2,1H3;1H
InChI key:DGSSJZJBCABUMD-UHFFFAOYSA-N
SMILES:CCC(=O)CN.Cl
Synonyms:
  • 2-Butanone, 1-amino-, hydrochloride (1:1)
  • 1-Aminobutan-2-one hydrochloride (1:1)
Found 4 products.