CymitQuimica logo

CAS 108662-49-3

:

2-CHLORO-5-FLUOROBENZIMIDAZOLE

Description:
2-Chloro-5-fluorobenzimidazole is a chemical compound characterized by its heterocyclic structure, which includes a benzene ring fused to an imidazole ring. The presence of chlorine and fluorine substituents at the 2 and 5 positions, respectively, contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals, particularly in the development of anti-cancer agents and other therapeutic compounds. Its molecular structure allows for various interactions, including hydrogen bonding and electrophilic substitution, making it a versatile intermediate in organic synthesis. Additionally, the presence of halogen atoms can influence the compound's solubility, stability, and biological activity. Safety data sheets indicate that it should be handled with care, as it may pose health risks upon exposure. Overall, 2-chloro-5-fluorobenzimidazole is an important compound in medicinal chemistry, with ongoing research into its applications and mechanisms of action.
Formula:C7H4ClFN2
InChI:InChI=1/C7H4ClFN2/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H,(H,10,11)
InChI key:UZIXQYXXJBMILL-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)[nH]c(Cl)n2
Synonyms:
  • 1H-Benzimidazole,2-chloro-5-fluoro-(9CI)
  • 2-Chloro-5-Fluoro-1H-Benzimidazole
  • 2-chloro-6-fluoro-1H-benzimidazole
Found 4 products.