CymitQuimica logo

CAS 108694-93-5

:

guanidine-D5 deuteriochloride

Description:
Guanidine-D5 deuteriochloride is a deuterated form of guanidine, a compound known for its strong basicity and presence in various biochemical processes. The "D5" indicates that five hydrogen atoms in the guanidine molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, such as its mass and vibrational characteristics, making it useful in studies involving nuclear magnetic resonance (NMR) spectroscopy and other analytical techniques. The presence of the chloride ion suggests that it is a salt, which can influence its solubility and reactivity in various solvents. Guanidine itself is a versatile building block in organic synthesis and is often used in the preparation of pharmaceuticals and agrochemicals. The deuterated version can be particularly valuable in research settings where tracking molecular behavior or interactions is essential. Overall, guanidine-D5 deuteriochloride serves as an important tool in both chemical research and applications.
Formula:CD5N3
InChI:InChI=1/CH5N3/c2-1(3)4/h(H5,2,3,4)/i/hD5
SMILES:C(=N[2H])(N([2H])[2H])N([2H])[2H]
Synonyms:
  • (2H5)guanidine
Found 1 products.