CAS 1087-09-8
:1,4-diphenylbut-2-yne-1,4-dione
Description:
1,4-Diphenylbut-2-yne-1,4-dione, with the CAS number 1087-09-8, is an organic compound characterized by its diketone structure, featuring two phenyl groups attached to a butyne backbone. This compound exhibits a conjugated system, which contributes to its potential for strong UV absorption and distinct color properties. It is typically a solid at room temperature and may appear as a yellow to orange crystalline substance. The presence of the diketone functional groups allows for reactivity typical of carbonyl compounds, including nucleophilic addition and condensation reactions. Additionally, its structure suggests potential applications in organic synthesis, materials science, and as a dye or pigment due to its chromophoric properties. The compound's stability and reactivity can be influenced by the substituents on the phenyl rings and the overall electronic environment. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled.
Formula:C16H10O2
InChI:InChI=1/C16H10O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-10H
SMILES:c1ccc(cc1)C(=O)C#CC(=O)c1ccccc1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Diphenyl-2-butyne-1,4-dione
CAS:Formula:C16H10O2Purity:>96.0%(GC)Color and Shape:Light orange to Yellow to Green powder to crystalMolecular weight:234.252-Butyne-1,4-dione,1,4-diphenyl-
CAS:Formula:C16H10O2Purity:96.0%Color and Shape:SolidMolecular weight:234.24941,4-Diphenyl-2-Butyne-1,4-Dione
CAS:1,4-Diphenyl-2-Butyne-1,4-DioneFormula:C16H10O2Purity:96%Molecular weight:234.251,4-Diphenyl-2-butyne-1,4-dione
CAS:1,4-Diphenyl-2-butyne-1,4-dione is a reactive compound that reacts with nucleophiles (such as hydroxide) to form an oxime. It is a chiral compound that has been shown to react with amines and hydrogen chloride in the presence of UV light. The UV absorption spectrum of 1,4-diphenyl-2-butyne-1,4-dione has been measured at wavelengths from 190 nm to 400 nm. The x-ray diffraction data showed the molecular structure of the molecule and revealed a very short bond length between the carbonyl group and hydrogen chloride.Formula:C16H10O2Purity:Min. 95%Color and Shape:White To Yellow SolidMolecular weight:234.25 g/mol




