CymitQuimica logo

CAS 1087-97-4

:

Benzoylmalonicaciddiethlyester; 95%

Description:
Benzoylmalonic acid diethyl ester, with the CAS number 1087-97-4, is an organic compound characterized by its ester functional groups and a malonic acid backbone. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its role in organic synthesis, particularly in the preparation of various derivatives and as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It exhibits moderate solubility in organic solvents, such as ethanol and ether, while being less soluble in water due to its hydrophobic ester groups. The compound is sensitive to moisture and should be stored in a cool, dry place to maintain its stability. Additionally, it may undergo hydrolysis in the presence of water, leading to the formation of malonic acid and ethanol. Safety precautions should be taken when handling this substance, as it may cause irritation to the skin and eyes. Proper personal protective equipment is recommended to minimize exposure.
Formula:C14H16O5
InChI:InChI=1/C14H16O5/c1-3-18-13(16)11(14(17)19-4-2)12(15)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3
InChI key:RIQBATDJIKIMBM-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C(=O)c1ccccc1)C(=O)OCC
Synonyms:
  • Benzoylmalonic acid diethly ester
  • Diethyl Benzoylpropanedioate
Found 4 products.