CymitQuimica logo

CAS 1087659-17-3

:

4,5-Dimethoxy-3-pyridinamine

Description:
4,5-Dimethoxy-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two methoxy groups (-OCH₃) at the 4 and 5 positions of the pyridine ring contributes to its chemical properties, enhancing its solubility in organic solvents and potentially influencing its reactivity. The amino group (-NH₂) at the 3 position provides basicity and can participate in hydrogen bonding, making the compound useful in various chemical reactions and applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy groups and the amino group, which may affect its synthesis and functionalization in laboratory settings. Overall, 4,5-Dimethoxy-3-pyridinamine is a versatile compound with potential applications in both research and industry.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-10-6-4-9-3-5(8)7(6)11-2/h3-4H,8H2,1-2H3
InChI key:InChIKey=KOSAVBLGLHXMDI-UHFFFAOYSA-N
SMILES:O(C)C=1C(OC)=C(N)C=NC1
Synonyms:
  • 4,5-Dimethoxy-3-pyridinamine
  • 3-Pyridinamine, 4,5-dimethoxy-
Found 2 products.