CymitQuimica logo

CAS 1087659-21-9

:

5-Bromo-3-pyridinyl 1,1-dimethylethyl carbonate

Description:
5-Bromo-3-pyridinyl 1,1-dimethylethyl carbonate is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a carbonate functional group. This compound typically exhibits properties associated with both the pyridine moiety and the carbonate group, such as moderate polarity and potential reactivity due to the presence of the bromine atom. It may be utilized in various chemical reactions, particularly in organic synthesis, where it can serve as an intermediate or a reagent. The presence of the 1,1-dimethylethyl group contributes to its steric hindrance, potentially influencing its reactivity and interactions with other molecules. Additionally, compounds like this may have applications in pharmaceuticals or agrochemicals, depending on their biological activity and stability. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose specific health and environmental risks. Overall, 5-Bromo-3-pyridinyl 1,1-dimethylethyl carbonate is a compound of interest in the field of organic chemistry.
Formula:C10H12BrNO3
InChI:InChI=1S/C10H12BrNO3/c1-10(2,3)15-9(13)14-8-4-7(11)5-12-6-8/h4-6H,1-3H3
InChI key:InChIKey=PTJSDWLLHABFKV-UHFFFAOYSA-N
SMILES:O(C(OC(C)(C)C)=O)C=1C=C(Br)C=NC1
Synonyms:
  • Carbonic acid, 5-bromo-3-pyridinyl 1,1-dimethylethyl ester
  • 5-Bromo-3-pyridinyl 1,1-dimethylethyl carbonate
  • 5-Bromopyridin-3-yl tert-butyl carbonate
Found 3 products.