CymitQuimica logo

CAS 108773-00-8

:

Benzothiazole, 2-chloro-4-methoxy-7-methyl- (9CI)

Description:
Benzothiazole, 2-chloro-4-methoxy-7-methyl- (9CI), with the CAS number 108773-00-8, is an organic compound that belongs to the benzothiazole family, characterized by a fused benzene and thiazole ring structure. This compound features a chlorine atom and a methoxy group at specific positions on the benzothiazole ring, along with a methyl group, which contribute to its unique chemical properties. It is typically a crystalline solid and may exhibit moderate solubility in organic solvents. Benzothiazole derivatives are known for their diverse applications, including use in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the chlorine and methoxy groups can influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit fluorescence properties, which can be useful in various analytical applications. As with many benzothiazole derivatives, it is essential to handle this substance with care, considering potential toxicity and environmental impact.
Formula:C9H8ClNOS
InChI:InChI=1S/C9H8ClNOS/c1-5-3-4-6(12-2)7-8(5)13-9(10)11-7/h3-4H,1-2H3
InChI key:USZSQTQJFWIVLM-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C=C1)OC)N=C(S2)Cl
Found 4 products.