CymitQuimica logo

CAS 1087792-10-6

:

2-[(4-Fluorophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid

Description:
2-[(4-Fluorophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a 4-fluorophenyl group, indicating the presence of a fluorine atom on a phenyl ring, which can influence its electronic properties and reactivity. The methyl groups contribute to the compound's hydrophobic characteristics, potentially affecting its solubility and biological activity. The carboxylic acid functional group (-COOH) is significant for its acidity and ability to participate in hydrogen bonding, which can enhance its interactions in biological systems. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development and other chemical syntheses.
Formula:C12H10FNO2S
InChI:InChI=1S/C12H10FNO2S/c1-7-11(12(15)16)17-10(14-7)6-8-2-4-9(13)5-3-8/h2-5H,6H2,1H3,(H,15,16)
InChI key:InChIKey=FGPZQXAGWWRIQC-UHFFFAOYSA-N
SMILES:C(C=1SC(C(O)=O)=C(C)N1)C2=CC=C(F)C=C2
Synonyms:
  • 5-Thiazolecarboxylic acid, 2-[(4-fluorophenyl)methyl]-4-methyl-
  • 2-(4-Fluorobenzyl)-4-methyl-1,3-thiazole-5-carboxylic acid
  • 2-[(4-Fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxylic acid
  • 2-[(4-Fluorophenyl)methyl]-4-methyl-5-thiazolecarboxylic acid
Found 1 products.