CymitQuimica logo

CAS 1087797-87-2

:

2,2,2-Trifluoroethyl N-(2-fluoro-5-methylphenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(2-fluoro-5-methylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a white to off-white solid at room temperature and is known for its stability under standard conditions. It exhibits moderate solubility in organic solvents, while its solubility in water is generally low due to the presence of hydrophobic fluorinated groups. The trifluoroethyl moiety contributes to its lipophilicity, which can influence its biological activity and interaction with various biological systems. The presence of the N-(2-fluoro-5-methylphenyl) substituent may impart specific reactivity and selectivity in chemical reactions, making it of interest in pharmaceutical and agrochemical applications. Additionally, the compound's fluorinated groups can enhance its metabolic stability and alter its pharmacokinetic properties. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit unique toxicological profiles.
Formula:C10H9F4NO2
InChI:InChI=1S/C10H9F4NO2/c1-6-2-3-7(11)8(4-6)15-9(16)17-5-10(12,13)14/h2-4H,5H2,1H3,(H,15,16)
InChI key:InChIKey=USEQMRQOTONYFK-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(F)C=CC(C)=C1
Synonyms:
  • 2,2,2-Trifluoroethyl N-(2-fluoro-5-methylphenyl)carbamate
  • Carbamic acid, N-(2-fluoro-5-methylphenyl)-, 2,2,2-trifluoroethyl ester
Found 1 products.