CymitQuimica logo

CAS 1087797-88-3

:

2,2,2-Trifluoroethyl N-[3-(methylthio)phenyl]carbamate

Description:
2,2,2-Trifluoroethyl N-[3-(methylthio)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. The presence of the trifluoroethyl moiety imparts significant lipophilicity and can enhance the compound's biological activity, making it of interest in various applications, including agrochemicals and pharmaceuticals. The methylthio group attached to the phenyl ring can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interaction with biological targets. This compound is typically synthesized through specific organic reactions that involve the formation of the carbamate linkage. Its physical properties, such as solubility, boiling point, and stability, would depend on the overall molecular structure and the presence of functional groups. Safety and handling considerations are essential, as with many fluorinated compounds, due to potential toxicity and environmental impact. Overall, 2,2,2-Trifluoroethyl N-[3-(methylthio)phenyl]carbamate represents a complex molecule with potential utility in various chemical and biological contexts.
Formula:C10H10F3NO2S
InChI:InChI=1S/C10H10F3NO2S/c1-17-8-4-2-3-7(5-8)14-9(15)16-6-10(11,12)13/h2-5H,6H2,1H3,(H,14,15)
InChI key:InChIKey=SDNLKHOWKPXPKJ-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC(SC)=CC=C1
Synonyms:
  • 2,2,2-Trifluoroethyl N-[3-(methylthio)phenyl]carbamate
  • Carbamic acid, N-[3-(methylthio)phenyl]-, 2,2,2-trifluoroethyl ester
Found 1 products.