CymitQuimica logo

CAS 1087798-10-4

:

2,2,2-Trifluoroethyl N-(3-chloro-2-fluorophenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(3-chloro-2-fluorophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a white to off-white solid at room temperature and is known for its moderate solubility in organic solvents. The presence of fluorine atoms contributes to its lipophilicity and potential biological activity, making it of interest in various fields, including agrochemicals and pharmaceuticals. The chloro and fluoro substituents on the phenyl ring can enhance its reactivity and selectivity in chemical reactions. Additionally, the carbamate moiety suggests potential applications in herbicides or insecticides, as carbamates are commonly used in these areas due to their ability to inhibit certain enzymes in pests. Safety data should be consulted for handling and exposure risks, as compounds with halogenated groups can exhibit toxicity and environmental persistence. Overall, this compound's unique characteristics make it a subject of interest for further research and application development.
Formula:C9H6ClF4NO2
InChI:InChI=1S/C9H6ClF4NO2/c10-5-2-1-3-6(7(5)11)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16)
InChI key:InChIKey=NVBDUMBAQSTUQI-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(F)C(Cl)=CC=C1
Synonyms:
  • Carbamic acid, N-(3-chloro-2-fluorophenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-(3-chloro-2-fluorophenyl)carbamate
Found 1 products.