CymitQuimica logo

CAS 1087798-12-6

:

2,2,2-Trifluoroethyl N-(4-ethylphenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(4-ethylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. The presence of three fluorine atoms in the trifluoroethyl moiety imparts significant polarity and influences the compound's solubility and reactivity. The N-(4-ethylphenyl) portion indicates that the carbamate is substituted with a 4-ethylphenyl group, which can affect the compound's biological activity and interaction with other molecules. This compound is likely to exhibit properties typical of carbamates, such as potential use as a pesticide or herbicide, due to its ability to inhibit certain enzymes. Additionally, the trifluoromethyl group can enhance lipophilicity, potentially affecting its absorption and distribution in biological systems. Safety and handling precautions are essential, as compounds with fluorinated groups can exhibit unique toxicological profiles. Overall, 2,2,2-Trifluoroethyl N-(4-ethylphenyl)carbamate represents a class of compounds with diverse applications in agrochemicals and pharmaceuticals.
Formula:C11H12F3NO2
InChI:InChI=1S/C11H12F3NO2/c1-2-8-3-5-9(6-4-8)15-10(16)17-7-11(12,13)14/h3-6H,2,7H2,1H3,(H,15,16)
InChI key:InChIKey=UDVWOUNGXJQXOG-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC=C(CC)C=C1
Synonyms:
  • Carbamic acid, N-(4-ethylphenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl 4-ethylphenylcarbamate
  • 2,2,2-Trifluoroethyl N-(4-ethylphenyl)carbamate
Found 1 products.