CymitQuimica logo

CAS 1087798-24-0

:

2,2,2-Trifluoroethyl N-[2-(trifluoromethoxy)phenyl]carbamate

Description:
2,2,2-Trifluoroethyl N-[2-(trifluoromethoxy)phenyl]carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a phenyl ring substituted with a trifluoromethoxy group. This compound is typically classified as a carbamate, which is a functional group derived from carbamic acid. The presence of multiple fluorine atoms contributes to its hydrophobic properties and can enhance its stability and reactivity in various chemical environments. The trifluoromethoxy group may impart additional electronic effects, influencing the compound's behavior in biological systems or chemical reactions. Such compounds are often of interest in agrochemical applications, particularly as potential pesticides or herbicides, due to their ability to interact with biological targets. Additionally, the fluorinated nature of this compound may affect its solubility and volatility, making it relevant in studies of environmental persistence and toxicity. Overall, 2,2,2-Trifluoroethyl N-[2-(trifluoromethoxy)phenyl]carbamate exemplifies the complexity and utility of fluorinated organic compounds in modern chemistry.
Formula:C10H7F6NO3
InChI:InChI=1S/C10H7F6NO3/c11-9(12,13)5-19-8(18)17-6-3-1-2-4-7(6)20-10(14,15)16/h1-4H,5H2,(H,17,18)
InChI key:InChIKey=YEFYKZRZNXFILP-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C(NC(OCC(F)(F)F)=O)C=CC=C1
Synonyms:
  • Carbamic acid, N-[2-(trifluoromethoxy)phenyl]-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-[2-(trifluoromethoxy)phenyl]carbamate
  • 2,2,2-Trifluoroethyl 2-(trifluoromethoxy)phenylcarbamate
Found 1 products.