CymitQuimica logo

CAS 1087798-31-9

:

2,2,2-Trifluoroethyl N-(2-ethylphenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(2-ethylphenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It exhibits moderate to high stability under standard conditions, but like many carbamates, it may be sensitive to hydrolysis in the presence of moisture or strong acids/bases. The trifluoroethyl group imparts notable properties, such as increased lipophilicity and potential bioactivity, making it of interest in various applications, including agrochemicals and pharmaceuticals. Its molecular interactions may be influenced by the presence of the ethylphenyl moiety, which can enhance its solubility and reactivity. Safety data should be consulted for handling, as compounds with fluorinated groups can exhibit unique toxicological profiles. Overall, 2,2,2-Trifluoroethyl N-(2-ethylphenyl)carbamate represents a specialized compound with potential utility in chemical synthesis and research.
Formula:C11H12F3NO2
InChI:InChI=1S/C11H12F3NO2/c1-2-8-5-3-4-6-9(8)15-10(16)17-7-11(12,13)14/h3-6H,2,7H2,1H3,(H,15,16)
InChI key:InChIKey=UKBDJRVRMFKLDA-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(CC)C=CC=C1
Synonyms:
  • Carbamic acid, N-(2-ethylphenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-(2-ethylphenyl)carbamate
  • 2,2,2-Trifluoroethyl 2-ethylphenylcarbamate
Found 1 products.