CymitQuimica logo

CAS 1087798-33-1

:

Carbamic acid, N-(2-bromophenyl)-, 2,2,2-trifluoroethyl ester

Description:
Carbamic acid, N-(2-bromophenyl)-, 2,2,2-trifluoroethyl ester is an organic compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a bromophenyl moiety, indicating the presence of a bromine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The 2,2,2-trifluoroethyl ester group contributes to its unique properties, including increased lipophilicity and potential for enhanced stability against hydrolysis. The trifluoromethyl groups are known to impart distinctive electronic effects, which can affect the compound's interaction with biological targets. This compound may exhibit specific pharmacological activities, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and materials science. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its characteristics and potential uses.
Formula:C9H7BrF3NO2
InChI:InChI=1S/C9H7BrF3NO2/c10-6-3-1-2-4-7(6)14-8(15)16-5-9(11,12)13/h1-4H,5H2,(H,14,15)
InChI key:InChIKey=MSKRHQHAMNKPFG-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=C(Br)C=CC=C1
Synonyms:
  • Carbamic acid, N-(2-bromophenyl)-, 2,2,2-trifluoroethyl ester
  • 2,2,2-Trifluoroethyl N-(2-bromophenyl)carbamate
Found 1 products.