CymitQuimica logo

CAS 1087798-37-5

:

2,2,2-Trifluoroethyl N-(3,5-difluorophenyl)carbamate

Description:
2,2,2-Trifluoroethyl N-(3,5-difluorophenyl)carbamate is a chemical compound characterized by its unique structure, which includes a trifluoroethyl group and a carbamate functional group attached to a difluorophenyl moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits high thermal stability and is likely to be soluble in organic solvents due to its polar functional groups. The presence of multiple fluorine atoms contributes to its lipophilicity and may enhance its biological activity, making it of interest in pharmaceutical and agrochemical applications. Additionally, the compound may exhibit specific reactivity patterns typical of carbamates, such as hydrolysis under certain conditions. Safety data sheets would indicate that it should be handled with care, as it may pose risks such as toxicity or environmental hazards. Overall, 2,2,2-Trifluoroethyl N-(3,5-difluorophenyl)carbamate represents a complex molecule with potential applications in various fields of chemistry.
Formula:C9H6F5NO2
InChI:InChI=1S/C9H6F5NO2/c10-5-1-6(11)3-7(2-5)15-8(16)17-4-9(12,13)14/h1-3H,4H2,(H,15,16)
InChI key:InChIKey=VEJZYQJNWQBTQG-UHFFFAOYSA-N
SMILES:N(C(OCC(F)(F)F)=O)C1=CC(F)=CC(F)=C1
Synonyms:
  • 2,2,2-Trifluoroethyl N-(3,5-difluorophenyl)carbamate
  • Carbamic acid, N-(3,5-difluorophenyl)-, 2,2,2-trifluoroethyl ester
Found 1 products.