CymitQuimica logo

CAS 1088-37-5

:

S-{3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]propyl} ethanethioate

Description:
S-{3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]propyl} ethanethioate, with the CAS number 1088-37-5, is a chemical compound characterized by its unique structural features, including a thioate functional group and an isoindole moiety. This compound typically exhibits properties associated with thioesters, such as susceptibility to hydrolysis and reactivity with nucleophiles. The presence of the dioxo-isoindole structure suggests potential applications in organic synthesis and medicinal chemistry, as isoindoles are known for their biological activity. The compound may also display moderate solubility in organic solvents, depending on the specific substituents and their interactions. Its reactivity profile could make it a candidate for further studies in drug development or as an intermediate in synthetic pathways. However, detailed studies on its physical and chemical properties, including stability, reactivity, and potential toxicity, would be necessary to fully understand its applications and safety profile.
Formula:C13H13NO4S
InChI:InChI=1/C13H13NO4S/c1-9(15)19-8-4-7-18-14-12(16)10-5-2-3-6-11(10)13(14)17/h2-3,5-6H,4,7-8H2,1H3
InChI key:BQPFTDMXVHNBRF-UHFFFAOYSA-N
SMILES:CC(=O)SCCCON1C(=O)c2ccccc2C1=O
Found 2 products.