CAS 1088-37-5

S-{3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]propyl} ethanethioate

Description:

S-{3-[(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)oxy]propyl} ethanethioate, with the CAS number 1088-37-5, is a chemical compound characterized by its unique structural features, including a thioate functional group and an isoindole moiety. This compound typically exhibits properties associated with thioesters, such as susceptibility to hydrolysis and reactivity with nucleophiles. The presence of the dioxo-isoindole structure suggests potential applications in organic synthesis and medicinal chemistry, as isoindoles are known for their biological activity. The compound may also display moderate solubility in organic solvents, depending on the specific substituents and their interactions. Its reactivity profile could make it a candidate for further studies in drug development or as an intermediate in synthetic pathways. However, detailed studies on its physical and chemical properties, including stability, reactivity, and potential toxicity, would be necessary to fully understand its applications and safety profile.

Formula: C₁₃H₁₃NO₄S

InChI: InChI=1/C13H13NO4S/c1-9(15)19-8-4-7-18-14-12(16)10-5-2-3-6-11(10)13(14)17/h2-3,5-6H,4,7-8H2,1H3

SMILES: CC(=O)SCCCON1C(=O)c2ccccc2C1=O

Ethanethioic Acid S-[3-[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]propyl] Ester

Controlled Product

CAS: 1088-37-5

Applications Ethanethioic Acid S-[3-[(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]propyl] Ester is an intermediate in the synthesis of heterobifunctional linkers for the conjugation of carbohydrates to protein.
References Bauer, L., et al.: J. Org. Chem., 30, 949 (1965)

Formula: C₁₃H₁₃NO₄S

Color and Shape: Neat

Molecular weight: 279.31

Ref: TR-E676460