CymitQuimica logo

CAS 108810-87-3

:

N-methyl-3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline

Description:
N-methyl-3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline is a chemical compound characterized by its complex structure, which includes a triazole ring fused to a pyridazine moiety. This compound features an aniline group, which contributes to its potential as a building block in pharmaceuticals or agrochemicals. The presence of the N-methyl group indicates that it has a methyl substituent on the nitrogen atom, which can influence its solubility and reactivity. The triazole and pyridazine rings are known for their biological activity, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly leading to pharmacological effects. The compound's properties, such as melting point, boiling point, solubility, and stability, would depend on its specific molecular interactions and the environment in which it is studied. Overall, N-methyl-3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)aniline represents a unique chemical entity with potential applications in various fields of research.
Formula:C13H13N5
InChI:InChI=1/C13H13N5/c1-9-15-16-13-7-6-12(17-18(9)13)10-4-3-5-11(8-10)14-2/h3-8,14H,1-2H3
SMILES:Cc1nnc2ccc(c3cccc(c3)NC)nn12
Synonyms:
  • N-METHYL-3-(3-METHYL[1,2,4]TRIAZOLO[4,3-B]PYRIDAZIN-6-YL)ANILINE
  • Benzenamine,N-methyl-3-(3-methyl-1,2,4-triazolo[4,3-b]pyridazin-6-yl)-
Found 1 products.