CymitQuimica logo

CAS 108825-65-6

:

N-methyl-N-[3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide

Description:
N-methyl-N-[3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide, with the CAS number 108825-65-6, is a chemical compound that belongs to a class of substances known for their potential pharmacological properties. This compound features a complex structure that includes a triazole ring fused to a pyridazine moiety, which contributes to its biological activity. The presence of the N-methyl and acetamide functional groups suggests that it may exhibit specific interactions with biological targets, potentially influencing its solubility and reactivity. The compound's molecular structure indicates that it may be lipophilic, which can affect its absorption and distribution in biological systems. Additionally, the presence of multiple aromatic rings may enhance its stability and influence its interaction with various receptors or enzymes. Overall, this compound's unique structural characteristics position it as a candidate for further investigation in medicinal chemistry and pharmacology, particularly in the context of developing new therapeutic agents.
Formula:C15H15N5O
InChI:InChI=1/C15H15N5O/c1-10-16-17-15-8-7-14(18-20(10)15)12-5-4-6-13(9-12)19(3)11(2)21/h4-9H,1-3H3
InChI key:WPAQLESUVYGUJZ-UHFFFAOYSA-N
SMILES:Cc1nnc2ccc(c3cccc(c3)N(C)C(=O)C)nn12
Found 7 products.