CymitQuimica logo

CAS 108847-21-8

:

B-2-Thianthrenylboronic acid

Description:
B-2-Thianthrenylboronic acid, with the CAS number 108847-21-8, is a boronic acid derivative characterized by the presence of a thianthrene moiety. This compound typically exhibits properties associated with both boronic acids and aromatic systems, including the ability to form reversible covalent bonds with diols, which is a key feature in applications such as organic synthesis and medicinal chemistry. The thianthrene structure contributes to its electronic properties, potentially enhancing its reactivity and stability. Additionally, boronic acids are known for their role in Suzuki coupling reactions, making B-2-Thianthrenylboronic acid a valuable intermediate in the synthesis of complex organic molecules. The compound may also exhibit unique solubility characteristics and reactivity patterns due to the presence of the sulfur atom in the thianthrene ring, which can influence its interactions with other chemical species. Overall, B-2-Thianthrenylboronic acid is a versatile compound with potential applications in various fields, including materials science and pharmaceuticals.
Formula:C12H9BO2S2
InChI:InChI=1S/C12H9BO2S2/c14-13(15)8-5-6-11-12(7-8)17-10-4-2-1-3-9(10)16-11/h1-7,14-15H
InChI key:InChIKey=GCSOJZMPHLRBMJ-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C2C(SC=3C(S2)=CC=CC3)=CC1
Synonyms:
  • 2-Thianthreneboronic acid
  • Boronic acid, 2-thianthrenyl-
  • Boronic acid, B-2-thianthrenyl-
  • (Thianthren-2-yl)boronic acid
  • B-2-Thianthrenylboronic acid
  • Thianthren-2-y1 boronic acid
Found 3 products.