CymitQuimica logo

CAS 1088496-42-7

:

[6-(1-hydroxy-1-methyl-ethyl)-3-pyridyl]boronic acid

Description:
[6-(1-hydroxy-1-methyl-ethyl)-3-pyridyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a hydroxymethyl substituent that enhances its solubility and reactivity. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The pyridine ring contributes to the compound's aromaticity and can participate in coordination chemistry. Additionally, the presence of the hydroxymethyl group may influence the compound's biological activity and interactions with other molecules. This substance is typically used in research settings, particularly in the development of boron-based reagents and catalysts. Its unique structural features allow it to play a role in the synthesis of complex organic molecules and in the study of biological systems, particularly in the context of drug development and molecular recognition processes.
Formula:C8H12BNO3
InChI:InChI=1S/C8H12BNO3/c1-8(2,11)7-4-3-6(5-10-7)9(12)13/h3-5,11-13H,1-2H3
InChI key:HQNCOBIVRYULKH-UHFFFAOYSA-N
SMILES:CC(C)(c1ccc(cn1)B(O)O)O
Synonyms:
  • (6-(2-Hydroxypropan-2-yl)pyridin-3-yl)boronic acid
  • 6-(2-Hydroxypropan-2-yl)pyridin-3-ylboronic acid
Found 2 products.