CymitQuimica logo

CAS 108857-24-5

:

2-AMINO-5-IODO-3-METHYLBENZOIC ACID

Description:
2-Amino-5-iodo-3-methylbenzoic acid is an organic compound characterized by the presence of an amino group, an iodine atom, and a carboxylic acid functional group attached to a methyl-substituted benzene ring. Its molecular structure features a benzene ring with three substituents: an amino group (-NH2) at the 2-position, an iodine atom at the 5-position, and a methyl group (-CH3) at the 3-position. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. It may exhibit acidic properties due to the carboxylic acid, while the amino group can act as a weak base. The iodine substituent can influence the compound's reactivity and stability, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups allows for potential interactions in biological systems, which may be of interest in medicinal chemistry.
Formula:C8H8INO2
InChI:InChI=1S/C8H8INO2/c1-4-2-5(9)3-6(7(4)10)8(11)12/h2-3H,10H2,1H3,(H,11,12)
InChI key:WFKOJKHXWWNXPK-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1N)C(=O)O)I
Found 4 products.