CymitQuimica logo

CAS 108875-45-2

:

Benzyl (2-oxoazepan-3-yl)carbamate

Description:
Benzyl (2-oxoazepan-3-yl)carbamate, identified by its CAS number 108875-45-2, is a chemical compound that features a carbamate functional group attached to a bicyclic structure. This compound is characterized by its azepane ring, which is a seven-membered saturated ring containing one nitrogen atom. The presence of the carbonyl group (2-oxo) contributes to its reactivity and potential applications in organic synthesis. The benzyl group enhances its lipophilicity, which can influence its solubility and biological activity. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The structural attributes suggest potential interactions with biological targets, although specific biological activities would require empirical investigation. Additionally, the compound's stability, reactivity, and potential toxicity would need to be assessed in the context of its intended use. Overall, Benzyl (2-oxoazepan-3-yl)carbamate represents a class of compounds that may have diverse applications in pharmaceuticals and organic synthesis.
Formula:C14H18N2O3
InChI:InChI=1S/C14H18N2O3/c17-13-12(8-4-5-9-15-13)16-14(18)19-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,15,17)(H,16,18)
InChI key:ZFWYCTUOFGJWRJ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COC(=NC1CCCCN=C1O)O
Found 2 products.