CymitQuimica logo

CAS 108885-62-7

:

(4S,5E,8R,9R)-4-Hydroxy-5-methyl-8-(1-methylethenyl)-10-oxabicyclo[7.2.1]dodeca-5,12-dien-11-one

Description:
The chemical substance known as (4S,5E,8R,9R)-4-Hydroxy-5-methyl-8-(1-methylethenyl)-10-oxabicyclo[7.2.1]dodeca-5,12-dien-11-one, with the CAS number 108885-62-7, is a bicyclic compound characterized by its complex structure featuring multiple stereocenters and functional groups. This compound contains a hydroxyl group (-OH), a ketone group (C=O), and a double bond, contributing to its reactivity and potential biological activity. The presence of the oxabicyclo framework indicates that it has a unique three-dimensional arrangement, which may influence its interactions with biological systems. The specific stereochemistry, denoted by the (4S,5E,8R,9R) configuration, suggests that it may exhibit chirality, leading to different biological effects depending on the orientation of its substituents. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential therapeutic properties. Further studies would be necessary to explore its specific applications and biological activities.
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-9(2)12-6-4-10(3)13(16)7-5-11-8-14(12)18-15(11)17/h4,8,12-14,16H,1,5-7H2,2-3H3/b10-4+/t12-,13+,14+/m1/s1
InChI key:XJUHTEFWFCFCBI-WENQCULDSA-N
SMILES:C/C/1=C\C[C@@H]([C@@H]2C=C(CC[C@@H]1O)C(=O)O2)C(=C)C
Synonyms:
  • 10-Oxabicyclo[7.2.1]dodeca-5,12-dien-11-one, 4-hydroxy-5-methyl-8-(1-methylethenyl)-, [4S-(4R*,5E,8S*,9S*)]-
  • 10-Oxabicyclo[7.2.1]dodeca-5,12-dien-11-one, 4-hydroxy-5-methyl-8-(1-methylethenyl)-, (4S,5E,8R,9R)-
  • Versicolactone B
  • (4S,5E,8R,9R)-4-Hydroxy-5-methyl-8-(1-methylethenyl)-10-oxabicyclo[7.2.1]dodeca-5,12-dien-11-one
Found 2 products.