CymitQuimica logo

CAS 1089282-52-9

:

1-Ethyl-2-fluoro-4-methoxy-5-nitrobenzene

Description:
1-Ethyl-2-fluoro-4-methoxy-5-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of an ethyl group indicates that it has a two-carbon alkyl chain, while the fluoro group suggests the presence of a fluorine atom, which can influence the compound's reactivity and polarity. The methoxy group (–OCH3) contributes to the compound's overall electron-donating properties, potentially affecting its chemical behavior and interactions. The nitro group (–NO2) is a strong electron-withdrawing group, which can enhance the compound's electrophilicity and reactivity in various chemical reactions. This compound may exhibit unique physical properties, such as solubility in organic solvents and specific melting or boiling points, influenced by the arrangement and nature of its substituents. Additionally, its potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and functional characteristics. Safety and handling considerations are essential due to the presence of the nitro group, which can pose hazards.
Formula:C9H10FNO3
InChI:InChI=1S/C9H10FNO3/c1-3-6-4-8(11(12)13)9(14-2)5-7(6)10/h4-5H,3H2,1-2H3
InChI key:InChIKey=PKSQQMMVEVQWDK-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(OC)C=C(F)C(CC)=C1
Synonyms:
  • 1-Ethyl-2-fluoro-4-methoxy-5-nitrobenzene
  • Benzene, 1-ethyl-2-fluoro-4-methoxy-5-nitro-
Found 4 products.