CAS 1089330-70-0

Formula: C5H3ClFNO2S

InChI: InChI=1S/C5H3ClFNO2S/c6-11(9,10)4-2-1-3-8-5(4)7/h1-3H

InChI key: MSOAVTSXBMHOEM-UHFFFAOYSA-N

SMILES: C1=CC(=C(N=C1)F)S(=O)(=O)Cl

2-Fluoro-pyridine-3-sulphonyl chloride

CAS: 1089330-70-0

2-Fluoro-pyridine-3-sulphonyl chloride

Formula: C₅H₃ClFNO₂S

Purity: ≥95%

Color and Shape: Yellow-brown Liquid-Oil

Molecular weight: 195.59922

Ref: 54-PC446034

2-Fluoropyridine-3-sulfonyl chloride

CAS: 1089330-70-0

Formula: C₅H₃ClFNO₂S

Purity: 97%

Color and Shape: Liquid

Molecular weight: 195.5992

Ref: IN-DA01C4ON

2-Fluoro-pyridine-3-sulfonyl chloride

CAS: 1089330-70-0

Formula: C₅H₃ClFNO₂S

Purity: 95%+

Color and Shape: Liquid, Oil

Molecular weight: 195.59

Ref: 10-F075634

2-Fluoro-pyridine-3-sulphonyl chloride

CAS: 1089330-70-0

Versatile small molecule scaffold

Formula: C₅H₃ClFNO₂S

Purity: Min. 95%

Molecular weight: 195.6 g/mol

Ref: 3D-PTB33070