CymitQuimica logo

CAS 108938-16-5

:

7-BROMO-5-METHYL-1H-INDOLE-2,3-DIONE

Description:
7-Bromo-5-methyl-1H-indole-2,3-dione, with the CAS number 108938-16-5, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a bromine atom at the 7-position and a methyl group at the 5-position of the indole ring, along with two carbonyl groups at the 2 and 3 positions, contributing to its diketone functionality. The presence of these functional groups imparts specific reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound is of interest in medicinal chemistry and research due to its potential biological activities, which may include antimicrobial or anticancer properties. Its solubility and stability can vary depending on the solvent and conditions, and it is typically handled with standard laboratory safety precautions due to the presence of bromine, which can be hazardous. Overall, 7-bromo-5-methyl-1H-indole-2,3-dione represents a versatile structure for further chemical exploration and application.
Formula:C9H6BrNO2
InChI:InChI=1/C9H6BrNO2/c1-4-2-5-7(6(10)3-4)11-9(13)8(5)12/h2-3H,1H3,(H,11,12,13)
InChI key:NPDJRIGMWAQKTQ-UHFFFAOYSA-N
SMILES:Cc1cc2c(c(c1)Br)NC(=O)C2=O
Synonyms:
  • Buttpark 50\07-85
  • Chembrdg-Bb 4010945
  • 7-Bromo-5-Methylindoline-2,3-Dione
  • Akos Bbs-00001014
Found 3 products.