CymitQuimica logo

CAS 108966-71-8

:

3,4-DIFLUOROBENZENESULFONAMIDE

Description:
3,4-Difluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a difluorobenzene ring. Its molecular structure features two fluorine atoms positioned at the 3 and 4 positions of the benzene ring, which significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and is soluble in polar solvents due to the sulfonamide group, which can engage in hydrogen bonding. 3,4-Difluorobenzenesulfonamide is of interest in medicinal chemistry and materials science, often serving as a building block in the synthesis of pharmaceuticals and agrochemicals. Its fluorinated structure may enhance biological activity and stability. Additionally, the compound's CAS number, 108966-71-8, is a unique identifier that facilitates its identification in chemical databases and regulatory frameworks. Overall, 3,4-difluorobenzenesulfonamide exhibits properties that make it valuable in various chemical applications, particularly in the development of new therapeutic agents.
Formula:C6H5F2NO2S
InChI:InChI=1/C6H5F2NO2S/c7-5-2-1-4(3-6(5)8)12(9,10)11/h1-3H,(H2,9,10,11)
InChI key:VFVVRYNJTGHAIE-UHFFFAOYSA-N
SMILES:c1cc(c(cc1S(=O)(=O)N)F)F
Synonyms:
  • 3,4-Difluorobenzenesulphonamide
  • Buttpark 21\07-17
  • Benzenesulfonamide, 3,4-difluoro- (9CI)
Found 5 products.