CymitQuimica logo

CAS 109029-96-1

:

2-Chloro-5-(4-morpholinylsulfonyl)benzoic acid

Description:
2-Chloro-5-(4-morpholinylsulfonyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a chlorine atom and a morpholinylsulfonyl group. This compound typically appears as a solid and is soluble in polar organic solvents. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. The presence of the morpholinylsulfonyl group enhances its potential as a pharmacological agent, as this moiety can influence biological activity and solubility. Additionally, the chlorine substituent can affect the compound's reactivity and interaction with biological targets. Overall, 2-Chloro-5-(4-morpholinylsulfonyl)benzoic acid is of interest in medicinal chemistry and may serve as a lead compound for the development of therapeutic agents. Its specific applications and efficacy would depend on further research and characterization in biological systems.
Formula:C11H12ClNO5S
InChI:InChI=1S/C11H12ClNO5S/c12-10-2-1-8(7-9(10)11(14)15)19(16,17)13-3-5-18-6-4-13/h1-2,7H,3-6H2,(H,14,15)
InChI key:InChIKey=GOWHUHLKBKFDKK-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(C(O)=O)=C(Cl)C=C1)N2CCOCC2
Synonyms:
  • 2-Chloro-5-(4-morpholinylsulfonyl)benzoic acid
  • 2-Chloro-5-[(morpholin-4-yl)sulfonyl]benzoic acid
  • 2-Chloro-5-(morpholinosulfonyl)benzoic acid
  • 2-Chloro-5-(morpholine-4-sulfonyl)benzoic acid
  • Benzoic acid, 2-chloro-5-(4-morpholinylsulfonyl)-
Found 3 products.