CAS 109073-77-0
:4,4'-Bis(hydroxymethyl)-2,2'-bipyridine
Description:
4,4'-Bis(hydroxymethyl)-2,2'-bipyridine, with the CAS number 109073-77-0, is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected by a central carbon atom bearing two hydroxymethyl groups. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of hydroxymethyl groups, which can engage in hydrogen bonding. It exhibits chelating properties, making it useful in coordination chemistry, particularly in the formation of metal complexes. The hydroxymethyl groups enhance its reactivity, allowing for further functionalization and modification. Additionally, this compound may have applications in materials science, catalysis, and as a ligand in various chemical reactions. Its stability and reactivity can be influenced by the pH and the presence of metal ions, making it a versatile compound in synthetic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H12N2O2
InChI:InChI=1/C12H12N2O2/c15-7-9-1-3-13-11(5-9)12-6-10(8-16)2-4-14-12/h1-6,15-16H,7-8H2
SMILES:c1cnc(cc1CO)c1cc(ccn1)CO
Synonyms:- [2,2'-Bipyridine]-4,4'-Dimethanol
- 2,2'-Bipyridine-4,4'-diyldimethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4,4'-Bis(hydroxymethyl)-2,2'-bipyridine
CAS:Formula:C12H12N2O2Purity:>95.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:216.24[2,2'-Bipyridine]-4,4'-diyldimethanol
CAS:Formula:C12H12N2O2Purity:97%Color and Shape:SolidMolecular weight:216.2359[2,2'-Bipyridine]-4,4'-diyldimethanol
CAS:[2,2'-Bipyridine]-4,4'-diyldimethanolPurity:98%Molecular weight:216.24g/mol4,4'-Bis(hydroxymethyl)-2,2'-bipyridine
CAS:4,4'-Bis(hydroxymethyl)-2,2'-bipyridinePurity:98%Molecular weight:216.239g/mol[2,2′-Bipyridine]-4,4′-diyldimethanol
CAS:Formula:C12H12N2O2Purity:95%Color and Shape:SolidMolecular weight:216.244,4'-Bis(hydroxymethyl)-2,2-bipyridine
CAS:4,4'-Bis(hydroxymethyl)-2,2-bipyridine is a replication inhibitor that has been used in the treatment of cancer. It has also been shown to be effective in the treatment of metabolic disorders and chronic bronchitis. 4,4'-Bis(hydroxymethyl)-2,2-bipyridine binds to the active site of human HMG-CoA reductase, which is an enzyme involved in cholesterol synthesis. This binding prevents the formation of HMG-CoA, preventing the conversion of acetyl coenzyme A into cholesterol. The drug also binds to microbial metabolism enzymes such as fatty acid synthase and alkanoic acid oxidoreductases and has significant cytotoxicity.Formula:C12H12N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:216.24 g/mol




