CymitQuimica logo

CAS 1092064-04-4

:

(αS,βS,11bS)-3,5-Dihydro-α-methyl-β-phenyl-4H-dinaphtho[2,1-c:1′,2′-e]phosphepin-4-ethanamine

Description:
The chemical substance known as "(αS,βS,11bS)-3,5-Dihydro-α-methyl-β-phenyl-4H-dinaphtho[2,1-c:1′,2′-e]phosphepin-4-ethanamine" with CAS number 1092064-04-4 is a complex organophosphorus compound. It features a unique dinaphtho structure, which contributes to its potential applications in various fields, including medicinal chemistry and materials science. The presence of a phosphine oxide moiety suggests that it may exhibit interesting reactivity and coordination properties, making it a candidate for catalysis or as a ligand in coordination chemistry. The stereochemistry indicated by the (αS, βS, 11bS) configuration implies that the compound has specific spatial arrangements that could influence its biological activity and interactions with other molecules. Additionally, the presence of both phenyl and ethyl groups may enhance its solubility and stability in organic solvents. Overall, this compound's intricate structure and functional groups suggest it could have diverse applications, although specific biological or chemical properties would require further investigation.
Formula:C31H28NP
InChI:InChI=1S/C31H28NP/c1-21(32)31(24-11-3-2-4-12-24)33-19-25-17-15-22-9-5-7-13-27(22)29(25)30-26(20-33)18-16-23-10-6-8-14-28(23)30/h2-18,21,31H,19-20,32H2,1H3
InChI key:InChIKey=BHRXRWRXVSJNML-UHFFFAOYSA-N
SMILES:C(C(C)N)(P1CC2=C(C=3C=4C(C=CC3C1)=CC=CC4)C=5C(C=C2)=CC=CC5)C6=CC=CC=C6
Synonyms:
  • (αS,βS,11bS)-3,5-Dihydro-α-methyl-β-phenyl-4H-dinaphtho[2,1-c:1′,2′-e]phosphepin-4-ethanamine
  • 4H-Dinaphtho[2,1-c:1′,2′-e]phosphepin-4-ethanamine, 3,5-dihydro-α-methyl-β-phenyl-, (αS,βS,11bS)-
Found 3 products.