CymitQuimica logo

CAS 109213-14-1

:

2-Thiophenesulfonamide, 5-(2-aminoethyl)-, hydrochloride (1:1)

Description:
2-Thiophenesulfonamide, 5-(2-aminoethyl)-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group and a thiophene ring, which contributes to its unique properties. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The thiophene moiety imparts aromatic characteristics, while the sulfonamide group enhances its potential for biological activity, making it of interest in medicinal chemistry. The aminoethyl side chain may facilitate interactions with biological targets, potentially influencing its pharmacological profile. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific activities would depend on the context of its use and the biological systems involved. Proper handling and storage conditions are essential to maintain its stability and efficacy in research or therapeutic applications.
Formula:C6H10N2O2S2·ClH
InChI:InChI=1S/C6H10N2O2S2.ClH/c7-4-3-5-1-2-6(11-5)12(8,9)10;/h1-2H,3-4,7H2,(H2,8,9,10);1H
InChI key:InChIKey=SEGMFFUUSBLGIW-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C=1SC(CCN)=CC1.Cl
Synonyms:
  • 2-Thiophenesulfonamide, 5-(2-aminoethyl)-, hydrochloride (1:1)
  • 2-Thiophenesulfonamide, 5-(2-aminoethyl)-, monohydrochloride
Found 1 products.