CymitQuimica logo

CAS 1092301-31-9

:

2,4,5,6-Tetrahydrocyclopenta[c]pyrazol-3-aMine

Description:
2,4,5,6-Tetrahydrocyclopenta[c]pyrazol-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a cyclopentane moiety. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as potential basicity due to the presence of amino groups. It may also display moderate solubility in polar solvents, depending on its functional groups and overall molecular structure. The presence of the amine group suggests that it could participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, compounds of this type may have applications in medicinal chemistry, potentially serving as intermediates or active pharmaceutical ingredients due to their biological activity. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise information. Overall, 2,4,5,6-Tetrahydrocyclopenta[c]pyrazol-3-amine represents a class of compounds with diverse chemical behavior and potential utility in various fields.
Formula:C6H9N3
InChI:InChI=1S/C6H9N3/c7-6-4-2-1-3-5(4)8-9-6/h1-3H2,(H3,7,8,9)
InChI key:OLPAMBOLEVAJJD-UHFFFAOYSA-N
SMILES:C1CC2=C(C1)NN=C2N
Synonyms:
  • 3-Cyclopentapyrazolamine, 2,4,5,6-tetrahydro-
  • 2,4,5,6-Tetrahydrocyclopenta[c]pyrazol-3-aMine
  • Tetrahydrocyclopenta[c]pyrazol-3-aMine
Found 2 products.