CymitQuimica logo

CAS 1092304-85-2

:

8-bromoquinolin-2-amine

Description:
8-Bromoquinolin-2-amine is an organic compound characterized by the presence of a bromine atom and an amino group attached to a quinoline ring system. This compound features a quinoline backbone, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The bromine substitution at the 8-position of the quinoline enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The amino group at the 2-position contributes to its potential as a ligand in coordination chemistry and may also affect its solubility and interaction with biological targets. This compound is typically used in research settings, particularly in studies related to pharmaceuticals, agrochemicals, and materials science. Its properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions and solvents used. Overall, 8-bromoquinolin-2-amine represents a versatile structure with potential applications in various fields of chemistry.
Formula:C9H7BrN2
InChI:InChI=1S/C9H7BrN2/c10-7-3-1-2-6-4-5-8(11)12-9(6)7/h1-5H,(H2,11,12)
InChI key:JCZCFNGKDJIKQI-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)Br)N=C(C=C2)N
Found 5 products.