CymitQuimica logo

CAS 1092351-86-4

:

methyl 2-methyl-2H-indazole-5-carboxylate

Description:
Methyl 2-methyl-2H-indazole-5-carboxylate is an organic compound characterized by its indazole structure, which features a five-membered ring containing two nitrogen atoms. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It possesses a carboxylate functional group, which contributes to its reactivity and solubility in various organic solvents. The presence of the methyl groups enhances its hydrophobic characteristics, influencing its interactions in biological systems. Methyl 2-methyl-2H-indazole-5-carboxylate is of interest in medicinal chemistry and drug development due to its potential biological activities, including anti-inflammatory and anticancer properties. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many chemical substances, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-12-6-8-5-7(10(13)14-2)3-4-9(8)11-12/h3-6H,1-2H3
InChI key:ZOXYVIUYSOLWRJ-UHFFFAOYSA-N
SMILES:CN1C=C2C=C(C=CC2=N1)C(=O)OC
Found 4 products.