CymitQuimica logo

CAS 1092351-96-6

:

5-Oxazolecarboxylic acid, 2-bromo-, methyl ester

Description:
5-Oxazolecarboxylic acid, 2-bromo-, methyl ester is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a carboxylic acid functional group that is esterified with a methyl group, indicating that it is a methyl ester. The presence of a bromine atom at the 2-position of the oxazole ring introduces a halogen substituent, which can influence the compound's reactivity and properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmaceutical research. The molecular structure suggests potential applications in organic synthesis and as intermediates in the production of more complex molecules. Additionally, the compound's solubility, stability, and reactivity can be affected by the presence of the bromine atom and the ester functional group, which may also influence its interactions in various chemical environments.
Formula:C5H4BrNO3
InChI:InChI=1S/C5H4BrNO3/c1-9-4(8)3-2-7-5(6)10-3/h2H,1H3
InChI key:VZASWAMBNWCQJL-UHFFFAOYSA-N
SMILES:COC(=O)C1=CN=C(O1)Br
Synonyms:
  • Methyl 2-broMo-1,3-oxazole-5-carboxylate
  • 5-Oxazolecarboxylic acid, 2-bromo-, methyl ester
  • Methyl2-broMooxazole-5-carboxylate
  • 2-Bromo-5-oxazolecarboxylic acid methyl ester
  • 2-BroMo-oxazole-5-carboxylic acid Methyl ester
Found 3 products.