CymitQuimica logo

CAS 1092352-02-7

:

3,5-Dibromo-2-iodopyrazine

Description:
3,5-Dibromo-2-iodopyrazine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. This compound features two bromine atoms located at the 3 and 5 positions and an iodine atom at the 2 position of the pyrazine ring, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogen substituents enhances its electrophilic character, making it useful in cross-coupling reactions and other synthetic transformations. Additionally, the compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, safety precautions should be taken when handling 3,5-dibromo-2-iodopyrazine due to potential toxicity and environmental concerns.
Formula:C4HBr2IN2
InChI:InChI=1S/C4HBr2IN2/c5-2-1-8-4(7)3(6)9-2/h1H
InChI key:InChIKey=BPZGVGFFYNDSBN-UHFFFAOYSA-N
SMILES:BrC=1C(I)=NC=C(Br)N1
Synonyms:
  • 3,5-Dibromo-2-iodopyrazine
  • Pyrazine, 3,5-dibromo-2-iodo-
Found 2 products.