CymitQuimica logo

CAS 1092352-47-0

:

Methyl 8-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-acetate

Description:
Methyl 8-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-acetate is a chemical compound characterized by its complex structure, which includes an imidazo-pyridine core, an iodine substituent, and a trifluoromethyl group. The presence of the iodine atom typically imparts unique reactivity, making it a potential candidate for various chemical transformations, including nucleophilic substitutions. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, often increasing potency in pharmaceutical applications. The acetate moiety suggests that the compound may exhibit ester-like properties, which can affect its solubility and stability. This compound is likely to be of interest in medicinal chemistry, particularly in the development of new therapeutic agents, due to its structural features that may interact with biological targets. Additionally, the presence of halogens and electron-withdrawing groups can significantly alter the electronic properties of the molecule, impacting its reactivity and interactions in various chemical environments.
Formula:C11H8F3IN2O2
InChI:InChI=1S/C11H8F3IN2O2/c1-19-9(18)3-7-5-17-4-6(11(12,13)14)2-8(15)10(17)16-7/h2,4-5H,3H2,1H3
InChI key:InChIKey=HRHUMTJCPYZLKV-UHFFFAOYSA-N
SMILES:IC=1C=2N(C=C(CC(OC)=O)N2)C=C(C(F)(F)F)C1
Synonyms:
  • Methyl 8-iodo-6-(trifluoromethyl)imidazo[1,2-a]pyridine-2-acetate
  • Imidazo[1,2-a]pyridine-2-acetic acid, 8-iodo-6-(trifluoromethyl)-, methyl ester
Found 1 products.