CymitQuimica logo

CAS 1092352-90-3

:

2-Chloro-4-pyridinecarboximidic acid hydrazide

Description:
2-Chloro-4-pyridinecarboximidic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a chloro group and a carboximidic acid hydrazide functional group. This compound typically exhibits properties associated with both hydrazides and pyridine derivatives, such as potential reactivity in condensation reactions and the ability to form hydrogen bonds due to the presence of the hydrazide moiety. It may also display biological activity, making it of interest in pharmaceutical research. The presence of the chlorine atom can influence its solubility and reactivity, while the pyridine ring contributes to its aromatic character. As with many nitrogen-containing compounds, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with any chemical substance, particularly those that may have toxicological implications. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including medicinal chemistry and agrochemicals.
Formula:C6H7ClN4
InChI:InChI=1S/C6H7ClN4/c7-5-3-4(1-2-10-5)6(8)11-9/h1-3H,9H2,(H2,8,11)
InChI key:InChIKey=MRYFCMRKCMVGHH-UHFFFAOYSA-N
SMILES:C(NN)(=N)C=1C=C(Cl)N=CC1
Synonyms:
  • 2-Chloro-4-pyridinecarboximidic acid hydrazide
  • 4-Pyridinecarboximidic acid, 2-chloro-, hydrazide
  • 2-chloro-4-pyridinecarboximidohydrazide
  • N'-amino-2-chloropyridine-4-carboximidamide
Found 1 products.