CymitQuimica logo

CAS 1092460-79-1

:

3-Chloro-4-(trifluoromethyl)benzonitrile

Description:
3-Chloro-4-(trifluoromethyl)benzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a trifluoromethyl group, as well as a nitrile functional group. The presence of the trifluoromethyl group contributes to its unique electronic properties, enhancing its lipophilicity and potentially influencing its reactivity and interactions in various chemical environments. The nitrile group (-C≡N) is known for its polar character, which can affect solubility and reactivity in organic synthesis. This compound is typically used in the field of medicinal chemistry and agrochemicals, where its structural features may impart specific biological activities or enhance the efficacy of certain applications. Additionally, the chlorine and trifluoromethyl substituents can significantly alter the compound's physical properties, such as boiling and melting points, as well as its stability under various conditions. Overall, 3-Chloro-4-(trifluoromethyl)benzonitrile is a versatile compound with potential applications in various chemical research areas.
Formula:C8H3ClF3N
InChI:InChI=1S/C8H3ClF3N/c9-7-3-5(4-13)1-2-6(7)8(10,11)12/h1-3H
InChI key:IWZFPSVQIDJRAD-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1C#N)Cl)C(F)(F)F
Synonyms:
  • 3-Chloro-4-(trifluoromethyl) benzonitrile
Found 5 products.