CymitQuimica logo

CAS 1092460-88-2

:

3-(Trifluoromethoxy)-5-fluorobenzylbromide

Description:
3-(Trifluoromethoxy)-5-fluorobenzylbromide is an organic compound characterized by its unique molecular structure, which includes a benzyl group substituted with both a bromine atom and a trifluoromethoxy group. The presence of the trifluoromethoxy group imparts significant polarity and can influence the compound's reactivity and solubility in various solvents. The fluorine atoms contribute to the compound's overall electronegativity, potentially enhancing its biological activity and making it a candidate for various applications in medicinal chemistry and agrochemicals. This compound is typically used in synthetic organic chemistry as an intermediate for the preparation of more complex molecules. Its reactivity is largely dictated by the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the presence of multiple fluorine atoms can affect the compound's stability and interaction with biological systems. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental impact.
Formula:C8H5BrF4O
InChI:InChI=1S/C13H20BNO2/c1-9-7-11(8-10(2)15-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3
InChI key:VUUGICQPCOWAIC-UHFFFAOYSA-N
SMILES:Cc1cc(cc(C)n1)B1OC(C)(C)C(C)(C)O1
Synonyms:
  • 2-(Bromomethyl)-4-Fluoro-1-(Trifluoromethoxy)Benzene
  • 2-(Trifluoromethoxy)-5-fluorobenzyl bromide
Found 1 products.