CymitQuimica logo

CAS 1092461-07-8

:

2-(Bromomethyl)-1,3-dichloro-4-(trifluoromethyl)benzene

Description:
2-(Bromomethyl)-1,3-dichloro-4-(trifluoromethyl)benzene is an organic compound characterized by its complex halogenated aromatic structure. It features a benzene ring substituted with multiple halogen atoms, specifically two chlorine atoms and one bromine atom, along with a trifluoromethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity. Additionally, the compound may exhibit significant thermal stability and resistance to degradation, making it suitable for specific industrial applications. However, the halogenated nature of the compound also raises environmental and health concerns, necessitating careful handling and disposal in accordance with safety regulations. Overall, 2-(Bromomethyl)-1,3-dichloro-4-(trifluoromethyl)benzene is a noteworthy example of a halogenated aromatic compound with diverse chemical properties.
Formula:C8H4BrCl2F3
InChI:InChI=1S/C8H4BrCl2F3/c9-3-4-6(10)2-1-5(7(4)11)8(12,13)14/h1-2H,3H2
InChI key:InChIKey=OAKBDJKNTUNRSH-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Cl)C(CBr)=C(Cl)C=C1
Synonyms:
  • 2-(Bromomethyl)-1,3-dichloro-4-(trifluoromethyl)benzene
  • 2,6-Dichloro-3-(trifluoromethyl)benzyl bromide
  • Benzene, 2-(bromomethyl)-1,3-dichloro-4-(trifluoromethyl)-
Found 3 products.