CymitQuimica logo

CAS 1092461-29-4

:

3-Ethoxy-2,6-difluorobenzenemethanamine

Description:
3-Ethoxy-2,6-difluorobenzenemethanamine is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two fluorine atoms and an ethoxy group, along with a primary amine functional group. The presence of the difluoromethyl group at the 2 and 6 positions of the benzene ring contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The ethoxy group, which is an ether, can influence the compound's polarity and hydrogen bonding capabilities. This compound may exhibit interesting biological activities due to the amine functionality, which can participate in various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where fluorinated compounds are often valued for their metabolic stability and lipophilicity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of 3-Ethoxy-2,6-difluorobenzenemethanamine would need to be assessed through further studies.
Formula:C9H11F2NO
InChI:InChI=1S/C9H11F2NO/c1-2-13-8-4-3-7(10)6(5-12)9(8)11/h3-4H,2,5,12H2,1H3
InChI key:InChIKey=GIDMHGPRTGIRRF-UHFFFAOYSA-N
SMILES:C(N)C1=C(F)C(OCC)=CC=C1F
Synonyms:
  • Benzenemethanamine, 3-ethoxy-2,6-difluoro-
  • 3-Ethoxy-2,6-difluorobenzenemethanamine
  • 3-Ethoxy-2,6-difluorobenzylamine
  • (3-Ethoxy-2,6-difluorophenyl)methanamine
Found 1 products.