
CAS 1092507-01-1
:1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetic acid
Description:
1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetic acid is a chemical compound characterized by its unique bicyclic structure, which incorporates both a tetrahydrofuran and an indene moiety. This compound features a carboxylic acid functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of multiple rings in its structure often imparts rigidity, influencing its conformational properties and interactions with biological systems. It may exhibit interesting pharmacological activities due to its structural complexity, making it a candidate for research in medicinal chemistry. The compound's molecular weight, melting point, and solubility characteristics would typically be determined through experimental methods, and its stability can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data sheets should be consulted for handling and toxicity information. Overall, 1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetic acid represents a fascinating subject for further study in organic synthesis and potential therapeutic applications.
Formula:C13H14O3
InChI:InChI=1S/C13H14O3/c14-12(15)7-9-2-1-8-3-4-11-10(13(8)9)5-6-16-11/h3-4,9H,1-2,5-7H2,(H,14,15)
InChI key:STJFPPKIYLSEKU-UHFFFAOYSA-N
SMILES:C1CC2=C(C1CC(=O)O)C3=C(C=C2)OCC3
Synonyms:- 2H-Indeno[5,4-b]furan-8-acetic acid, 1,6,7,8-tetrahydro-
- 1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-acetic acid
- 2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)acetic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
